C19H23FN3O3+ — CID 9431809
(2R)-N-[(4-fluorophenyl)methyl]-2-[4-(furan-2-carbonyl)piperazin-1-ium-1-yl]propanamide (PubChem CID 9431809) has the molecular formula C19H23FN3O3+ and a molecular weight of 360.41 g/mol. Its IUPAC name is (2R)-N-[(4-fluorophenyl)methyl]-2-[4-(furan-2-carbonyl)piperazin-1-ium-1-yl]propanamide.
| Compound Name | (2R)-N-[(4-fluorophenyl)methyl]-2-[4-(furan-2-carbonyl)piperazin-1-ium-1-yl]propanamide |
|---|---|
| PubChem CID | 9431809 |
| Molecular Formula | C19H23FN3O3+ |
| Molecular Weight | 360.41 g/mol |
| Exact Mass | 360.17 |
| IUPAC Name | (2R)-N-[(4-fluorophenyl)methyl]-2-[4-(furan-2-carbonyl)piperazin-1-ium-1-yl]propanamide |
| SMILES | C[C@H](C(=O)NCc1ccc(F)cc1)[NH+]1CCN(C(=O)c2ccco2)CC1 |
| InChI | InChI=1S/C19H22FN3O3/c1-14(18(24)21-13-15-4-6-16(20)7-5-15)22-8-10-23(11-9-22)19(25)17-3-2-12-26-17/h2-7,12,14H,8-11,13H2,1H3,(H,21,24)/p+1/t14-/m1/s1 |
| InChIKey | KXEZOBAJEAAKND-CQSZACIVSA-O |
| XLogP | 0.46 |
| TPSA | 66.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.41 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |