C14H22N3O3+ — CID 8549233
(2S)-N-ethyl-2-[4-(furan-2-carbonyl)piperazin-1-ium-1-yl]propanamide (PubChem CID 8549233) has the molecular formula C14H22N3O3+ and a molecular weight of 280.35 g/mol. Its IUPAC name is (2S)-N-ethyl-2-[4-(furan-2-carbonyl)piperazin-1-ium-1-yl]propanamide.
| Compound Name | (2S)-N-ethyl-2-[4-(furan-2-carbonyl)piperazin-1-ium-1-yl]propanamide |
|---|---|
| PubChem CID | 8549233 |
| Molecular Formula | C14H22N3O3+ |
| Molecular Weight | 280.35 g/mol |
| Exact Mass | 280.17 |
| IUPAC Name | (2S)-N-ethyl-2-[4-(furan-2-carbonyl)piperazin-1-ium-1-yl]propanamide |
| SMILES | CCNC(=O)[C@H](C)[NH+]1CCN(C(=O)c2ccco2)CC1 |
| InChI | InChI=1S/C14H21N3O3/c1-3-15-13(18)11(2)16-6-8-17(9-7-16)14(19)12-5-4-10-20-12/h4-5,10-11H,3,6-9H2,1-2H3,(H,15,18)/p+1/t11-/m0/s1 |
| InChIKey | PGTDQZOOMFTPHF-NSHDSACASA-O |
| XLogP | -0.86 |
| TPSA | 66.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.35 |
| LogP ≤ 5 | -0.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |