C28H31FN4O4 — CID 42678153
N-[(4-fluorophenyl)methyl]-2-[4-(furan-2-carbonyl)-1,4-diazepan-1-yl]-5-(2-methylpropanoylamino)benzamide (PubChem CID 42678153) has the molecular formula C28H31FN4O4 and a molecular weight of 506.58 g/mol. Its IUPAC name is N-[(4-fluorophenyl)methyl]-2-[4-(furan-2-carbonyl)-1,4-diazepan-1-yl]-5-(2-methylpropanoylamino)benzamide.
| Compound Name | N-[(4-fluorophenyl)methyl]-2-[4-(furan-2-carbonyl)-1,4-diazepan-1-yl]-5-(2-methylpropanoylamino)benzamide |
|---|---|
| PubChem CID | 42678153 |
| Molecular Formula | C28H31FN4O4 |
| Molecular Weight | 506.58 g/mol |
| Exact Mass | 506.23 |
| IUPAC Name | N-[(4-fluorophenyl)methyl]-2-[4-(furan-2-carbonyl)-1,4-diazepan-1-yl]-5-(2-methylpropanoylamino)benzamide |
| SMILES | CC(C)C(=O)Nc1ccc(N2CCCN(C(=O)c3ccco3)CC2)c(C(=O)NCc2ccc(F)cc2)c1 |
| InChI | InChI=1S/C28H31FN4O4/c1-19(2)26(34)31-22-10-11-24(23(17-22)27(35)30-18-20-6-8-21(29)9-7-20)32-12-4-13-33(15-14-32)28(36)25-5-3-16-37-25/h3,5-11,16-17,19H,4,12-15,18H2,1-2H3,(H,30,35)(H,31,34) |
| InChIKey | SFQGFMMPKQMLNL-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 94.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.58 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|