C15H25ClN2O — CID 119674320
2-amino-N-benzyl-N-ethyl-3-methylpentanamide;hydrochloride (PubChem CID 119674320) has the molecular formula C15H25ClN2O and a molecular weight of 284.83 g/mol. Its IUPAC name is 2-amino-N-benzyl-N-ethyl-3-methylpentanamide;hydrochloride.
| Compound Name | 2-amino-N-benzyl-N-ethyl-3-methylpentanamide;hydrochloride |
|---|---|
| PubChem CID | 119674320 |
| Molecular Formula | C15H25ClN2O |
| Molecular Weight | 284.83 g/mol |
| Exact Mass | 284.17 |
| IUPAC Name | 2-amino-N-benzyl-N-ethyl-3-methylpentanamide;hydrochloride |
| SMILES | CCC(C)C(N)C(=O)N(CC)Cc1ccccc1.Cl |
| InChI | InChI=1S/C15H24N2O.ClH/c1-4-12(3)14(16)15(18)17(5-2)11-13-9-7-6-8-10-13;/h6-10,12,14H,4-5,11,16H2,1-3H3;1H |
| InChIKey | MBRGYAWAQMWUJF-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.83 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |