C15H22BrN3O2 — CID 60963304
2-amino-N-(2-amino-2-oxoethyl)-N-[(4-bromophenyl)methyl]-3-methylpentanamide (PubChem CID 60963304) has the molecular formula C15H22BrN3O2 and a molecular weight of 356.26 g/mol. Its IUPAC name is 2-amino-N-(2-amino-2-oxoethyl)-N-[(4-bromophenyl)methyl]-3-methylpentanamide.
| Compound Name | 2-amino-N-(2-amino-2-oxoethyl)-N-[(4-bromophenyl)methyl]-3-methylpentanamide |
|---|---|
| PubChem CID | 60963304 |
| Molecular Formula | C15H22BrN3O2 |
| Molecular Weight | 356.26 g/mol |
| Exact Mass | 355.09 |
| IUPAC Name | 2-amino-N-(2-amino-2-oxoethyl)-N-[(4-bromophenyl)methyl]-3-methylpentanamide |
| SMILES | CCC(C)C(N)C(=O)N(CC(N)=O)Cc1ccc(Br)cc1 |
| InChI | InChI=1S/C15H22BrN3O2/c1-3-10(2)14(18)15(21)19(9-13(17)20)8-11-4-6-12(16)7-5-11/h4-7,10,14H,3,8-9,18H2,1-2H3,(H2,17,20) |
| InChIKey | RQRLYCPLLHJWCF-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 89.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.26 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |