C9H8F3NO4S — CID 67419335
(benzylsulfonylamino) 2,2,2-trifluoroacetate (PubChem CID 67419335) has the molecular formula C9H8F3NO4S and a molecular weight of 283.23 g/mol. Its IUPAC name is (benzylsulfonylamino) 2,2,2-trifluoroacetate.
| Compound Name | (benzylsulfonylamino) 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 67419335 |
| Molecular Formula | C9H8F3NO4S |
| Molecular Weight | 283.23 g/mol |
| Exact Mass | 283.01 |
| IUPAC Name | (benzylsulfonylamino) 2,2,2-trifluoroacetate |
| SMILES | O=C(ONS(=O)(=O)Cc1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C9H8F3NO4S/c10-9(11,12)8(14)17-13-18(15,16)6-7-4-2-1-3-5-7/h1-5,13H,6H2 |
| InChIKey | QKTCZXKWBDEESW-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.23 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|