C13H19NO3S — CID 174337929
N-benzylsulfonyl-2,2-dimethylbutanamide (PubChem CID 174337929) has the molecular formula C13H19NO3S and a molecular weight of 269.37 g/mol. Its IUPAC name is N-benzylsulfonyl-2,2-dimethylbutanamide.
| Compound Name | N-benzylsulfonyl-2,2-dimethylbutanamide |
|---|---|
| PubChem CID | 174337929 |
| Molecular Formula | C13H19NO3S |
| Molecular Weight | 269.37 g/mol |
| Exact Mass | 269.11 |
| IUPAC Name | N-benzylsulfonyl-2,2-dimethylbutanamide |
| SMILES | CCC(C)(C)C(=O)NS(=O)(=O)Cc1ccccc1 |
| InChI | InChI=1S/C13H19NO3S/c1-4-13(2,3)12(15)14-18(16,17)10-11-8-6-5-7-9-11/h5-9H,4,10H2,1-3H3,(H,14,15) |
| InChIKey | XCTMLAZQWLBLBQ-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.37 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |