C12H16N2O2S — CID 61123309
N-(2-cyanobutan-2-yl)-1-phenylmethanesulfonamide (PubChem CID 61123309) has the molecular formula C12H16N2O2S and a molecular weight of 252.34 g/mol. Its IUPAC name is N-(2-cyanobutan-2-yl)-1-phenylmethanesulfonamide.
| Compound Name | N-(2-cyanobutan-2-yl)-1-phenylmethanesulfonamide |
|---|---|
| PubChem CID | 61123309 |
| Molecular Formula | C12H16N2O2S |
| Molecular Weight | 252.34 g/mol |
| Exact Mass | 252.09 |
| IUPAC Name | N-(2-cyanobutan-2-yl)-1-phenylmethanesulfonamide |
| SMILES | CCC(C)(C#N)NS(=O)(=O)Cc1ccccc1 |
| InChI | InChI=1S/C12H16N2O2S/c1-3-12(2,10-13)14-17(15,16)9-11-7-5-4-6-8-11/h4-8,14H,3,9H2,1-2H3 |
| InChIKey | OJJBTIXPASLSFH-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 69.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.34 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |