C15H21NO3S — CID 167754039
N-(5-hydroxy-2,5-dimethylhex-3-yn-2-yl)-1-phenylmethanesulfonamide (PubChem CID 167754039) has the molecular formula C15H21NO3S and a molecular weight of 295.40 g/mol. Its IUPAC name is N-(5-hydroxy-2,5-dimethylhex-3-yn-2-yl)-1-phenylmethanesulfonamide.
| Compound Name | N-(5-hydroxy-2,5-dimethylhex-3-yn-2-yl)-1-phenylmethanesulfonamide |
|---|---|
| PubChem CID | 167754039 |
| Molecular Formula | C15H21NO3S |
| Molecular Weight | 295.40 g/mol |
| Exact Mass | 295.12 |
| IUPAC Name | N-(5-hydroxy-2,5-dimethylhex-3-yn-2-yl)-1-phenylmethanesulfonamide |
| SMILES | CC(C)(O)C#CC(C)(C)NS(=O)(=O)Cc1ccccc1 |
| InChI | InChI=1S/C15H21NO3S/c1-14(2,10-11-15(3,4)17)16-20(18,19)12-13-8-6-5-7-9-13/h5-9,16-17H,12H2,1-4H3 |
| InChIKey | WFZXJBKKJSLLPT-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.40 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|