C19H36N2O3S — CID 91132595
2,2-dimethyl-N-(phenylsulfamoyl)butanamide;ethane;2-methylbutane (PubChem CID 91132595) has the molecular formula C19H36N2O3S and a molecular weight of 372.58 g/mol. Its IUPAC name is 2,2-dimethyl-N-(phenylsulfamoyl)butanamide;ethane;2-methylbutane.
| Compound Name | 2,2-dimethyl-N-(phenylsulfamoyl)butanamide;ethane;2-methylbutane |
|---|---|
| PubChem CID | 91132595 |
| Molecular Formula | C19H36N2O3S |
| Molecular Weight | 372.58 g/mol |
| Exact Mass | 372.24 |
| IUPAC Name | 2,2-dimethyl-N-(phenylsulfamoyl)butanamide;ethane;2-methylbutane |
| SMILES | CC.CCC(C)(C)C(=O)NS(=O)(=O)Nc1ccccc1.CCC(C)C |
| InChI | InChI=1S/C12H18N2O3S.C5H12.C2H6/c1-4-12(2,3)11(15)14-18(16,17)13-10-8-6-5-7-9-10;1-4-5(2)3;1-2/h5-9,13H,4H2,1-3H3,(H,14,15);5H,4H2,1-3H3;1-2H3 |
| InChIKey | OHOMXRRAFGICBM-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.58 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |