C22H39NO — CID 174845109
2,6-dimethyloctane;2,2-dimethyl-N-phenylbutanamide (PubChem CID 174845109) has the molecular formula C22H39NO and a molecular weight of 333.56 g/mol. Its IUPAC name is 2,6-dimethyloctane;2,2-dimethyl-N-phenylbutanamide.
| Compound Name | 2,6-dimethyloctane;2,2-dimethyl-N-phenylbutanamide |
|---|---|
| PubChem CID | 174845109 |
| Molecular Formula | C22H39NO |
| Molecular Weight | 333.56 g/mol |
| Exact Mass | 333.30 |
| IUPAC Name | 2,6-dimethyloctane;2,2-dimethyl-N-phenylbutanamide |
| SMILES | CCC(C)(C)C(=O)Nc1ccccc1.CCC(C)CCCC(C)C |
| InChI | InChI=1S/C12H17NO.C10H22/c1-4-12(2,3)11(14)13-10-8-6-5-7-9-10;1-5-10(4)8-6-7-9(2)3/h5-9H,4H2,1-3H3,(H,13,14);9-10H,5-8H2,1-4H3 |
| InChIKey | JLSDWQOUTBKLCB-UHFFFAOYSA-N |
| XLogP | 6.92 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.56 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |