C16H15F3N2O2S — CID 137319141
1-phenyl-N-[(1,1,1-trifluoro-3-phenylpropan-2-ylidene)amino]methanesulfonamide (PubChem CID 137319141) has the molecular formula C16H15F3N2O2S and a molecular weight of 356.37 g/mol. Its IUPAC name is 1-phenyl-N-[(1,1,1-trifluoro-3-phenylpropan-2-ylidene)amino]methanesulfonamide.
| Compound Name | 1-phenyl-N-[(1,1,1-trifluoro-3-phenylpropan-2-ylidene)amino]methanesulfonamide |
|---|---|
| PubChem CID | 137319141 |
| Molecular Formula | C16H15F3N2O2S |
| Molecular Weight | 356.37 g/mol |
| Exact Mass | 356.08 |
| IUPAC Name | 1-phenyl-N-[(1,1,1-trifluoro-3-phenylpropan-2-ylidene)amino]methanesulfonamide |
| SMILES | O=S(=O)(Cc1ccccc1)NN=C(Cc1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C16H15F3N2O2S/c17-16(18,19)15(11-13-7-3-1-4-8-13)20-21-24(22,23)12-14-9-5-2-6-10-14/h1-10,21H,11-12H2 |
| InChIKey | VDMCUEFCMJYFQQ-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 58.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.37 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|