C42H38N2O5S — CID 141195832
N-[[1-[3,5-bis(phenylmethoxy)phenyl]-2-(4-phenylmethoxyphenyl)ethylidene]amino]-1-phenylmethanesulfonamide (PubChem CID 141195832) has the molecular formula C42H38N2O5S and a molecular weight of 682.84 g/mol. Its IUPAC name is N-[[1-[3,5-bis(phenylmethoxy)phenyl]-2-(4-phenylmethoxyphenyl)ethylidene]amino]-1-phenylmethanesulfonamide.
| Compound Name | N-[[1-[3,5-bis(phenylmethoxy)phenyl]-2-(4-phenylmethoxyphenyl)ethylidene]amino]-1-phenylmethanesulfonamide |
|---|---|
| PubChem CID | 141195832 |
| Molecular Formula | C42H38N2O5S |
| Molecular Weight | 682.84 g/mol |
| Exact Mass | 682.25 |
| IUPAC Name | N-[[1-[3,5-bis(phenylmethoxy)phenyl]-2-(4-phenylmethoxyphenyl)ethylidene]amino]-1-phenylmethanesulfonamide |
| SMILES | O=S(=O)(Cc1ccccc1)NN=C(Cc1ccc(OCc2ccccc2)cc1)c1cc(OCc2ccccc2)cc(OCc2ccccc2)c1 |
| InChI | InChI=1S/C42H38N2O5S/c45-50(46,32-37-19-11-4-12-20-37)44-43-42(25-33-21-23-39(24-22-33)47-29-34-13-5-1-6-14-34)38-26-40(48-30-35-15-7-2-8-16-35)28-41(27-38)49-31-36-17-9-3-10-18-36/h1-24,26-28,44H,25,29-32H2 |
| InChIKey | BFXOJIHJOCEKEW-UHFFFAOYSA-N |
| XLogP | 8.49 |
| TPSA | 86.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 682.84 |
| LogP ≤ 5 | 8.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|