C25H28N2O6S — CID 141351759
N-[[2-(3,4-dimethoxyphenyl)-1-(3,5-dimethoxyphenyl)ethylidene]amino]-1-phenylmethanesulfonamide (PubChem CID 141351759) has the molecular formula C25H28N2O6S and a molecular weight of 484.57 g/mol. Its IUPAC name is N-[[2-(3,4-dimethoxyphenyl)-1-(3,5-dimethoxyphenyl)ethylidene]amino]-1-phenylmethanesulfonamide.
| Compound Name | N-[[2-(3,4-dimethoxyphenyl)-1-(3,5-dimethoxyphenyl)ethylidene]amino]-1-phenylmethanesulfonamide |
|---|---|
| PubChem CID | 141351759 |
| Molecular Formula | C25H28N2O6S |
| Molecular Weight | 484.57 g/mol |
| Exact Mass | 484.17 |
| IUPAC Name | N-[[2-(3,4-dimethoxyphenyl)-1-(3,5-dimethoxyphenyl)ethylidene]amino]-1-phenylmethanesulfonamide |
| SMILES | COc1cc(OC)cc(C(Cc2ccc(OC)c(OC)c2)=NNS(=O)(=O)Cc2ccccc2)c1 |
| InChI | InChI=1S/C25H28N2O6S/c1-30-21-14-20(15-22(16-21)31-2)23(12-19-10-11-24(32-3)25(13-19)33-4)26-27-34(28,29)17-18-8-6-5-7-9-18/h5-11,13-16,27H,12,17H2,1-4H3 |
| InChIKey | KIVIBCQJHBULKL-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 95.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.57 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|