C6H9F3N2O3 — CID 87260139
(2S)-2-hydroxy-2-methyl-N'-(2,2,2-trifluoroethyl)propanediamide (PubChem CID 87260139) has the molecular formula C6H9F3N2O3 and a molecular weight of 214.14 g/mol. Its IUPAC name is (2S)-2-hydroxy-2-methyl-N'-(2,2,2-trifluoroethyl)propanediamide.
| Compound Name | (2S)-2-hydroxy-2-methyl-N'-(2,2,2-trifluoroethyl)propanediamide |
|---|---|
| PubChem CID | 87260139 |
| Molecular Formula | C6H9F3N2O3 |
| Molecular Weight | 214.14 g/mol |
| Exact Mass | 214.06 |
| IUPAC Name | (2S)-2-hydroxy-2-methyl-N'-(2,2,2-trifluoroethyl)propanediamide |
| SMILES | C[C@](O)(C(N)=O)C(=O)NCC(F)(F)F |
| InChI | InChI=1S/C6H9F3N2O3/c1-5(14,3(10)12)4(13)11-2-6(7,8)9/h14H,2H2,1H3,(H2,10,12)(H,11,13)/t5-/m0/s1 |
| InChIKey | IASGYANUWRQMKL-YFKPBYRVSA-N |
| XLogP | -1.10 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.14 |
| LogP ≤ 5 | -1.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|