C7H10F3NOS — CID 89320251
(Z)-3-sulfanyl-4-(2,2,2-trifluoroethylamino)pent-3-en-2-one (PubChem CID 89320251) has the molecular formula C7H10F3NOS and a molecular weight of 213.22 g/mol. Its IUPAC name is (Z)-3-sulfanyl-4-(2,2,2-trifluoroethylamino)pent-3-en-2-one.
| Compound Name | (Z)-3-sulfanyl-4-(2,2,2-trifluoroethylamino)pent-3-en-2-one |
|---|---|
| PubChem CID | 89320251 |
| Molecular Formula | C7H10F3NOS |
| Molecular Weight | 213.22 g/mol |
| Exact Mass | 213.04 |
| IUPAC Name | (Z)-3-sulfanyl-4-(2,2,2-trifluoroethylamino)pent-3-en-2-one |
| SMILES | CC(=O)/C(S)=C(\C)NCC(F)(F)F |
| InChI | InChI=1S/C7H10F3NOS/c1-4(6(13)5(2)12)11-3-7(8,9)10/h11,13H,3H2,1-2H3/b6-4- |
| InChIKey | OFCSCEJPRBJBLJ-XQRVVYSFSA-N |
| XLogP | 1.89 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.22 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|