C9H14F4N2O3 — CID 114169813
2-[(2,2,3,3-tetrafluoropropylcarbamoylamino)methyl]butanoic acid (PubChem CID 114169813) has the molecular formula C9H14F4N2O3 and a molecular weight of 274.21 g/mol. Its IUPAC name is 2-[(2,2,3,3-tetrafluoropropylcarbamoylamino)methyl]butanoic acid.
| Compound Name | 2-[(2,2,3,3-tetrafluoropropylcarbamoylamino)methyl]butanoic acid |
|---|---|
| PubChem CID | 114169813 |
| Molecular Formula | C9H14F4N2O3 |
| Molecular Weight | 274.21 g/mol |
| Exact Mass | 274.09 |
| IUPAC Name | 2-[(2,2,3,3-tetrafluoropropylcarbamoylamino)methyl]butanoic acid |
| SMILES | CCC(CNC(=O)NCC(F)(F)C(F)F)C(=O)O |
| InChI | InChI=1S/C9H14F4N2O3/c1-2-5(6(16)17)3-14-8(18)15-4-9(12,13)7(10)11/h5,7H,2-4H2,1H3,(H,16,17)(H2,14,15,18) |
| InChIKey | JWFHXEVBNJGJOX-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.21 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|