C13H16F4N2O — CID 106291040
2-(aminomethyl)-3-phenyl-N-(2,2,3,3-tetrafluoropropyl)propanamide (PubChem CID 106291040) has the molecular formula C13H16F4N2O and a molecular weight of 292.28 g/mol. Its IUPAC name is 2-(aminomethyl)-3-phenyl-N-(2,2,3,3-tetrafluoropropyl)propanamide.
| Compound Name | 2-(aminomethyl)-3-phenyl-N-(2,2,3,3-tetrafluoropropyl)propanamide |
|---|---|
| PubChem CID | 106291040 |
| Molecular Formula | C13H16F4N2O |
| Molecular Weight | 292.28 g/mol |
| Exact Mass | 292.12 |
| IUPAC Name | 2-(aminomethyl)-3-phenyl-N-(2,2,3,3-tetrafluoropropyl)propanamide |
| SMILES | NCC(Cc1ccccc1)C(=O)NCC(F)(F)C(F)F |
| InChI | InChI=1S/C13H16F4N2O/c14-12(15)13(16,17)8-19-11(20)10(7-18)6-9-4-2-1-3-5-9/h1-5,10,12H,6-8,18H2,(H,19,20) |
| InChIKey | CUXZYKRVOVJVHO-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.28 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|