C14H18F6O4 — CID 173178621
diethyl 2,3-bis(1,1,1-trifluoropropan-2-yl)but-2-enedioate (PubChem CID 173178621) has the molecular formula C14H18F6O4 and a molecular weight of 364.28 g/mol. Its IUPAC name is diethyl 2,3-bis(1,1,1-trifluoropropan-2-yl)but-2-enedioate.
| Compound Name | diethyl 2,3-bis(1,1,1-trifluoropropan-2-yl)but-2-enedioate |
|---|---|
| PubChem CID | 173178621 |
| Molecular Formula | C14H18F6O4 |
| Molecular Weight | 364.28 g/mol |
| Exact Mass | 364.11 |
| IUPAC Name | diethyl 2,3-bis(1,1,1-trifluoropropan-2-yl)but-2-enedioate |
| SMILES | CCOC(=O)C(=C(C(=O)OCC)C(C)C(F)(F)F)C(C)C(F)(F)F |
| InChI | InChI=1S/C14H18F6O4/c1-5-23-11(21)9(7(3)13(15,16)17)10(12(22)24-6-2)8(4)14(18,19)20/h7-8H,5-6H2,1-4H3 |
| InChIKey | WYGYWHADTXYEKQ-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.28 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|