C16H20F6N2O8 — CID 23236194
ethyl 2-[(5R)-5-[(2S,3R)-1-ethoxy-4,4,4-trifluoro-3-hydroxy-1-oxobutan-2-yl]-3,6-dioxopiperazin-2-yl]-4,4,4-trifluoro-3-hydroxybutanoate (PubChem CID 23236194) has the molecular formula C16H20F6N2O8 and a molecular weight of 482.33 g/mol. Its IUPAC name is ethyl 2-[(5R)-5-[(2S,3R)-1-ethoxy-4,4,4-trifluoro-3-hydroxy-1-oxobutan-2-yl]-3,6-dioxopiperazin-2-yl]-4,4,4-trifluoro-3-hydroxybutanoate.
| Compound Name | ethyl 2-[(5R)-5-[(2S,3R)-1-ethoxy-4,4,4-trifluoro-3-hydroxy-1-oxobutan-2-yl]-3,6-dioxopiperazin-2-yl]-4,4,4-trifluoro-3-hydroxybutanoate |
|---|---|
| PubChem CID | 23236194 |
| Molecular Formula | C16H20F6N2O8 |
| Molecular Weight | 482.33 g/mol |
| Exact Mass | 482.11 |
| IUPAC Name | ethyl 2-[(5R)-5-[(2S,3R)-1-ethoxy-4,4,4-trifluoro-3-hydroxy-1-oxobutan-2-yl]-3,6-dioxopiperazin-2-yl]-4,4,4-trifluoro-3-hydroxybutanoate |
| SMILES | CCOC(=O)C(C1NC(=O)[C@@H]([C@H](C(=O)OCC)[C@@H](O)C(F)(F)F)NC1=O)C(O)C(F)(F)F |
| InChI | InChI=1S/C16H20F6N2O8/c1-3-31-13(29)5(9(25)15(17,18)19)7-11(27)24-8(12(28)23-7)6(14(30)32-4-2)10(26)16(20,21)22/h5-10,25-26H,3-4H2,1-2H3,(H,23,28)(H,24,27)/t5-,6?,7+,8?,9+,10?/m0/s1 |
| InChIKey | SJLUFPZXFZEZJO-CNEXAIPUSA-N |
| XLogP | -0.83 |
| TPSA | 151.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.33 |
| LogP ≤ 5 | -0.83 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |