C22H14F30O2S2 — CID 15104073
ethyl 2-(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecylsulfanyl)-2-(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctylsulfanyl)acetate (PubChem CID 15104073) has the molecular formula C22H14F30O2S2 and a molecular weight of 944.43 g/mol. Its IUPAC name is ethyl 2-(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecylsulfanyl)-2-(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctylsulfanyl)acetate.
| Compound Name | ethyl 2-(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecylsulfanyl)-2-(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctylsulfanyl)acetate |
|---|---|
| PubChem CID | 15104073 |
| Molecular Formula | C22H14F30O2S2 |
| Molecular Weight | 944.43 g/mol |
| Exact Mass | 944.00 |
| IUPAC Name | ethyl 2-(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecylsulfanyl)-2-(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctylsulfanyl)acetate |
| SMILES | CCOC(=O)C(SCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)SCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C22H14F30O2S2/c1-2-54-7(53)8(56-6-4-10(25,26)12(29,30)14(33,34)17(39,40)19(43,44)21(47,48)49)55-5-3-9(23,24)11(27,28)13(31,32)15(35,36)16(37,38)18(41,42)20(45,46)22(50,51)52/h8H,2-6H2,1H3 |
| InChIKey | LWIINQOYVLTTOA-UHFFFAOYSA-N |
| XLogP | 11.87 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 944.43 |
| LogP ≤ 5 | 11.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|