C5H7I3O2 — CID 13086506
methyl 2,4,4-triiodobutanoate (PubChem CID 13086506) has the molecular formula C5H7I3O2 and a molecular weight of 479.82 g/mol. Its IUPAC name is methyl 2,4,4-triiodobutanoate.
| Compound Name | methyl 2,4,4-triiodobutanoate |
|---|---|
| PubChem CID | 13086506 |
| Molecular Formula | C5H7I3O2 |
| Molecular Weight | 479.82 g/mol |
| Exact Mass | 479.76 |
| IUPAC Name | methyl 2,4,4-triiodobutanoate |
| SMILES | COC(=O)C(I)CC(I)I |
| InChI | InChI=1S/C5H7I3O2/c1-10-5(9)3(6)2-4(7)8/h3-4H,2H2,1H3 |
| InChIKey | OCYQFNRTDMLBJV-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.82 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|