C11H5F18NO5S — CID 100944000
2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluorooctyl N-(2,2,2-trifluoroethoxysulfonyl)carbamate (PubChem CID 100944000) has the molecular formula C11H5F18NO5S and a molecular weight of 605.19 g/mol. Its IUPAC name is 2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluorooctyl N-(2,2,2-trifluoroethoxysulfonyl)carbamate.
| Compound Name | 2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluorooctyl N-(2,2,2-trifluoroethoxysulfonyl)carbamate |
|---|---|
| PubChem CID | 100944000 |
| Molecular Formula | C11H5F18NO5S |
| Molecular Weight | 605.19 g/mol |
| Exact Mass | 604.96 |
| IUPAC Name | 2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluorooctyl N-(2,2,2-trifluoroethoxysulfonyl)carbamate |
| SMILES | O=C(NS(=O)(=O)OCC(F)(F)F)OCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C11H5F18NO5S/c12-4(13,1-34-3(31)30-36(32,33)35-2-5(14,15)16)6(17,18)7(19,20)8(21,22)9(23,24)10(25,26)11(27,28)29/h1-2H2,(H,30,31) |
| InChIKey | BCEJALHAJHIDEL-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.19 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|