C14H13F17N2O7S — CID 101486109
2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,9-heptadecafluorononyl N-[[1,3-dihydroxy-2-(hydroxymethyl)propan-2-yl]carbamoyl]sulfamate (PubChem CID 101486109) has the molecular formula C14H13F17N2O7S and a molecular weight of 676.30 g/mol. Its IUPAC name is 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,9-heptadecafluorononyl N-[[1,3-dihydroxy-2-(hydroxymethyl)propan-2-yl]carbamoyl]sulfamate.
| Compound Name | 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,9-heptadecafluorononyl N-[[1,3-dihydroxy-2-(hydroxymethyl)propan-2-yl]carbamoyl]sulfamate |
|---|---|
| PubChem CID | 101486109 |
| Molecular Formula | C14H13F17N2O7S |
| Molecular Weight | 676.30 g/mol |
| Exact Mass | 676.02 |
| IUPAC Name | 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,9-heptadecafluorononyl N-[[1,3-dihydroxy-2-(hydroxymethyl)propan-2-yl]carbamoyl]sulfamate |
| SMILES | O=C(NC(CO)(CO)CO)NS(=O)(=O)OCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C14H13F17N2O7S/c15-7(16,4-40-41(38,39)33-5(37)32-6(1-34,2-35)3-36)8(17,18)9(19,20)10(21,22)11(23,24)12(25,26)13(27,28)14(29,30)31/h34-36H,1-4H2,(H2,32,33,37) |
| InChIKey | YPGQCIFROLCGLP-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 145.19 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 676.30 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|