C9H13F5O2 — CID 58984108
1,1,1,3,3-pentafluoropropan-2-yl 2,2-dimethylbutanoate (PubChem CID 58984108) has the molecular formula C9H13F5O2 and a molecular weight of 248.19 g/mol. Its IUPAC name is 1,1,1,3,3-pentafluoropropan-2-yl 2,2-dimethylbutanoate.
| Compound Name | 1,1,1,3,3-pentafluoropropan-2-yl 2,2-dimethylbutanoate |
|---|---|
| PubChem CID | 58984108 |
| Molecular Formula | C9H13F5O2 |
| Molecular Weight | 248.19 g/mol |
| Exact Mass | 248.08 |
| IUPAC Name | 1,1,1,3,3-pentafluoropropan-2-yl 2,2-dimethylbutanoate |
| SMILES | CCC(C)(C)C(=O)OC(C(F)F)C(F)(F)F |
| InChI | InChI=1S/C9H13F5O2/c1-4-8(2,3)7(15)16-5(6(10)11)9(12,13)14/h5-6H,4H2,1-3H3 |
| InChIKey | PYVPYWGZVAULCR-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.19 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |