C24H43F3O7 — CID 90707424
(1-methoxy-2-methylpropyl) 2,2-dimethylbutanoate;[2-oxo-2-(1,1,1-trifluoro-3-methylbutan-2-yl)oxyethyl] 2,2-dimethylbutanoate (PubChem CID 90707424) has the molecular formula C24H43F3O7 and a molecular weight of 500.60 g/mol. Its IUPAC name is (1-methoxy-2-methylpropyl) 2,2-dimethylbutanoate;[2-oxo-2-(1,1,1-trifluoro-3-methylbutan-2-yl)oxyethyl] 2,2-dimethylbutanoate.
| Compound Name | (1-methoxy-2-methylpropyl) 2,2-dimethylbutanoate;[2-oxo-2-(1,1,1-trifluoro-3-methylbutan-2-yl)oxyethyl] 2,2-dimethylbutanoate |
|---|---|
| PubChem CID | 90707424 |
| Molecular Formula | C24H43F3O7 |
| Molecular Weight | 500.60 g/mol |
| Exact Mass | 500.30 |
| IUPAC Name | (1-methoxy-2-methylpropyl) 2,2-dimethylbutanoate;[2-oxo-2-(1,1,1-trifluoro-3-methylbutan-2-yl)oxyethyl] 2,2-dimethylbutanoate |
| SMILES | CCC(C)(C)C(=O)OC(OC)C(C)C.CCC(C)(C)C(=O)OCC(=O)OC(C(C)C)C(F)(F)F |
| InChI | InChI=1S/C13H21F3O4.C11H22O3/c1-6-12(4,5)11(18)19-7-9(17)20-10(8(2)3)13(14,15)16;1-7-11(4,5)10(12)14-9(13-6)8(2)3/h8,10H,6-7H2,1-5H3;8-9H,7H2,1-6H3 |
| InChIKey | ONDUJDHMWUJPTA-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.60 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|