About (5,5,5-trifluoro-4-hydroxypentan-2-yl) 2,2-dimethylbutanoate
(5,5,5-trifluoro-4-hydroxypentan-2-yl) 2,2-dimethylbutanoate (PubChem CID 59126267) has the molecular formula C11H19F3O3
and a molecular weight of 256.26 g/mol. Its IUPAC name is (5,5,5-trifluoro-4-hydroxypentan-2-yl) 2,2-dimethylbutanoate.
Analyze (5,5,5-trifluoro-4-hydroxypentan-2-yl) 2,2-dimethylbutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5,5,5-trifluoro-4-hydroxypentan-2-yl) 2,2-dimethylbutanoate?
The IUPAC name of (5,5,5-trifluoro-4-hydroxypentan-2-yl) 2,2-dimethylbutanoate (CID 59126267) is (5,5,5-trifluoro-4-hydroxypentan-2-yl) 2,2-dimethylbutanoate.
What is the SMILES notation for (5,5,5-trifluoro-4-hydroxypentan-2-yl) 2,2-dimethylbutanoate?
The canonical SMILES for (5,5,5-trifluoro-4-hydroxypentan-2-yl) 2,2-dimethylbutanoate is CCC(C)(C)C(=O)OC(C)CC(O)C(F)(F)F.
What is the InChIKey of (5,5,5-trifluoro-4-hydroxypentan-2-yl) 2,2-dimethylbutanoate?
The InChIKey is VSPVLQSVQCYQBW-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H19F3O3/c1-5-10(3,4)9(16)17-7(2)6-8(15)11(12,13)14/h7-8,15H,5-6H2,1-4H3.
What are the key properties of (5,5,5-trifluoro-4-hydroxypentan-2-yl) 2,2-dimethylbutanoate?
(5,5,5-trifluoro-4-hydroxypentan-2-yl) 2,2-dimethylbutanoate has a molecular weight of 256.26 g/mol, XLogP of 2.67, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (5,5,5-trifluoro-4-hydroxypentan-2-yl) 2,2-dimethylbutanoate is sourced from PubChem (CID 59126267), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).