About (3,3,6,6-tetrafluoro-2-methylhexan-2-yl) 2,2-dimethylbutanoate
(3,3,6,6-tetrafluoro-2-methylhexan-2-yl) 2,2-dimethylbutanoate (PubChem CID 118912389) has the molecular formula C13H22F4O2
and a molecular weight of 286.31 g/mol. Its IUPAC name is (3,3,6,6-tetrafluoro-2-methylhexan-2-yl) 2,2-dimethylbutanoate.
Analyze (3,3,6,6-tetrafluoro-2-methylhexan-2-yl) 2,2-dimethylbutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3,3,6,6-tetrafluoro-2-methylhexan-2-yl) 2,2-dimethylbutanoate?
The IUPAC name of (3,3,6,6-tetrafluoro-2-methylhexan-2-yl) 2,2-dimethylbutanoate (CID 118912389) is (3,3,6,6-tetrafluoro-2-methylhexan-2-yl) 2,2-dimethylbutanoate.
What is the SMILES notation for (3,3,6,6-tetrafluoro-2-methylhexan-2-yl) 2,2-dimethylbutanoate?
The canonical SMILES for (3,3,6,6-tetrafluoro-2-methylhexan-2-yl) 2,2-dimethylbutanoate is CCC(C)(C)C(=O)OC(C)(C)C(F)(F)CCC(F)F.
What is the InChIKey of (3,3,6,6-tetrafluoro-2-methylhexan-2-yl) 2,2-dimethylbutanoate?
The InChIKey is RBEGPIZPFYKBAY-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H22F4O2/c1-6-11(2,3)10(18)19-12(4,5)13(16,17)8-7-9(14)15/h9H,6-8H2,1-5H3.
What are the key properties of (3,3,6,6-tetrafluoro-2-methylhexan-2-yl) 2,2-dimethylbutanoate?
(3,3,6,6-tetrafluoro-2-methylhexan-2-yl) 2,2-dimethylbutanoate has a molecular weight of 286.31 g/mol, XLogP of 4.43, 7 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3,3,6,6-tetrafluoro-2-methylhexan-2-yl) 2,2-dimethylbutanoate is sourced from PubChem (CID 118912389), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).