C13H21F7O3 — CID 91236073
(1-fluoro-2-methylpropan-2-yl) 2,2-dimethylbutanoate;1,1,1,2,3,3-hexafluoropropan-2-ol (PubChem CID 91236073) has the molecular formula C13H21F7O3 and a molecular weight of 358.29 g/mol. Its IUPAC name is (1-fluoro-2-methylpropan-2-yl) 2,2-dimethylbutanoate;1,1,1,2,3,3-hexafluoropropan-2-ol.
| Compound Name | (1-fluoro-2-methylpropan-2-yl) 2,2-dimethylbutanoate;1,1,1,2,3,3-hexafluoropropan-2-ol |
|---|---|
| PubChem CID | 91236073 |
| Molecular Formula | C13H21F7O3 |
| Molecular Weight | 358.29 g/mol |
| Exact Mass | 358.14 |
| IUPAC Name | (1-fluoro-2-methylpropan-2-yl) 2,2-dimethylbutanoate;1,1,1,2,3,3-hexafluoropropan-2-ol |
| SMILES | CCC(C)(C)C(=O)OC(C)(C)CF.OC(F)(C(F)F)C(F)(F)F |
| InChI | InChI=1S/C10H19FO2.C3H2F6O/c1-6-9(2,3)8(12)13-10(4,5)7-11;4-1(5)2(6,10)3(7,8)9/h6-7H2,1-5H3;1,10H |
| InChIKey | XIXLLYCPIIUGMQ-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.29 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |