C14H30O4Si — CID 150898745
2,2-diethoxyethyl-[5-(oxiran-2-ylmethoxy)pentyl]silane (PubChem CID 150898745) has the molecular formula C14H30O4Si and a molecular weight of 290.48 g/mol. Its IUPAC name is 2,2-diethoxyethyl-[5-(oxiran-2-ylmethoxy)pentyl]silane.
| Compound Name | 2,2-diethoxyethyl-[5-(oxiran-2-ylmethoxy)pentyl]silane |
|---|---|
| PubChem CID | 150898745 |
| Molecular Formula | C14H30O4Si |
| Molecular Weight | 290.48 g/mol |
| Exact Mass | 290.19 |
| IUPAC Name | 2,2-diethoxyethyl-[5-(oxiran-2-ylmethoxy)pentyl]silane |
| SMILES | CCOC(C[SiH2]CCCCCOCC1CO1)OCC |
| InChI | InChI=1S/C14H30O4Si/c1-3-16-14(17-4-2)12-19-9-7-5-6-8-15-10-13-11-18-13/h13-14H,3-12,19H2,1-2H3 |
| InChIKey | KZOHVQVVYSFKJT-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 40.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.48 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|