C16H17NO5S — CID 100918521
(2-hydroxy-3-oxo-2,3-diphenylpropyl) N-methylsulfamate (PubChem CID 100918521) has the molecular formula C16H17NO5S and a molecular weight of 335.38 g/mol. Its IUPAC name is (2-hydroxy-3-oxo-2,3-diphenylpropyl) N-methylsulfamate.
| Compound Name | (2-hydroxy-3-oxo-2,3-diphenylpropyl) N-methylsulfamate |
|---|---|
| PubChem CID | 100918521 |
| Molecular Formula | C16H17NO5S |
| Molecular Weight | 335.38 g/mol |
| Exact Mass | 335.08 |
| IUPAC Name | (2-hydroxy-3-oxo-2,3-diphenylpropyl) N-methylsulfamate |
| SMILES | CNS(=O)(=O)OCC(O)(C(=O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C16H17NO5S/c1-17-23(20,21)22-12-16(19,14-10-6-3-7-11-14)15(18)13-8-4-2-5-9-13/h2-11,17,19H,12H2,1H3 |
| InChIKey | LQPCQWHVNXBLHL-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.38 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |