C21H19NO2 — CID 154714165
(2S)-3-anilino-2-hydroxy-1,2-diphenylpropan-1-one (PubChem CID 154714165) has the molecular formula C21H19NO2 and a molecular weight of 317.39 g/mol. Its IUPAC name is (2S)-3-anilino-2-hydroxy-1,2-diphenylpropan-1-one.
| Compound Name | (2S)-3-anilino-2-hydroxy-1,2-diphenylpropan-1-one |
|---|---|
| PubChem CID | 154714165 |
| Molecular Formula | C21H19NO2 |
| Molecular Weight | 317.39 g/mol |
| Exact Mass | 317.14 |
| IUPAC Name | (2S)-3-anilino-2-hydroxy-1,2-diphenylpropan-1-one |
| SMILES | O=C(c1ccccc1)[C@@](O)(CNc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C21H19NO2/c23-20(17-10-4-1-5-11-17)21(24,18-12-6-2-7-13-18)16-22-19-14-8-3-9-15-19/h1-15,22,24H,16H2/t21-/m1/s1 |
| InChIKey | GIOVZKNSCROBQK-OAQYLSRUSA-N |
| XLogP | 3.87 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.39 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |