C22H20O5S — CID 87615156
3-(2-hydroxy-3-oxo-2,3-diphenylpropyl)-4-methylbenzenesulfonic acid (PubChem CID 87615156) has the molecular formula C22H20O5S and a molecular weight of 396.46 g/mol. Its IUPAC name is 3-(2-hydroxy-3-oxo-2,3-diphenylpropyl)-4-methylbenzenesulfonic acid.
| Compound Name | 3-(2-hydroxy-3-oxo-2,3-diphenylpropyl)-4-methylbenzenesulfonic acid |
|---|---|
| PubChem CID | 87615156 |
| Molecular Formula | C22H20O5S |
| Molecular Weight | 396.46 g/mol |
| Exact Mass | 396.10 |
| IUPAC Name | 3-(2-hydroxy-3-oxo-2,3-diphenylpropyl)-4-methylbenzenesulfonic acid |
| SMILES | Cc1ccc(S(=O)(=O)O)cc1CC(O)(C(=O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C22H20O5S/c1-16-12-13-20(28(25,26)27)14-18(16)15-22(24,19-10-6-3-7-11-19)21(23)17-8-4-2-5-9-17/h2-14,24H,15H2,1H3,(H,25,26,27) |
| InChIKey | MYTCVSWALLGJSZ-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 91.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.46 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|