C17H20O3Si — CID 175160957
methyl 4,4-diphenyl-4-silyloxybutanoate (PubChem CID 175160957) has the molecular formula C17H20O3Si and a molecular weight of 300.43 g/mol. Its IUPAC name is methyl 4,4-diphenyl-4-silyloxybutanoate.
| Compound Name | methyl 4,4-diphenyl-4-silyloxybutanoate |
|---|---|
| PubChem CID | 175160957 |
| Molecular Formula | C17H20O3Si |
| Molecular Weight | 300.43 g/mol |
| Exact Mass | 300.12 |
| IUPAC Name | methyl 4,4-diphenyl-4-silyloxybutanoate |
| SMILES | COC(=O)CCC(O[SiH3])(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C17H20O3Si/c1-19-16(18)12-13-17(20-21,14-8-4-2-5-9-14)15-10-6-3-7-11-15/h2-11H,12-13H2,1,21H3 |
| InChIKey | IUHNCSCCLJVQHG-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.43 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|