C16H14Cl2O3 — CID 70447241
2-(1,1-dichloroethoxy)-2-hydroxy-1,2-diphenylethanone (PubChem CID 70447241) has the molecular formula C16H14Cl2O3 and a molecular weight of 325.19 g/mol. Its IUPAC name is 2-(1,1-dichloroethoxy)-2-hydroxy-1,2-diphenylethanone.
| Compound Name | 2-(1,1-dichloroethoxy)-2-hydroxy-1,2-diphenylethanone |
|---|---|
| PubChem CID | 70447241 |
| Molecular Formula | C16H14Cl2O3 |
| Molecular Weight | 325.19 g/mol |
| Exact Mass | 324.03 |
| IUPAC Name | 2-(1,1-dichloroethoxy)-2-hydroxy-1,2-diphenylethanone |
| SMILES | CC(Cl)(Cl)OC(O)(C(=O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C16H14Cl2O3/c1-15(17,18)21-16(20,13-10-6-3-7-11-13)14(19)12-8-4-2-5-9-12/h2-11,20H,1H3 |
| InChIKey | UTTDUNLRLVOERT-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.19 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|