C34H38N2O7 — CID 54008657
2,2-bis[2-(1,3-dihydroxy-4,5,6,7-tetrahydroisoindol-2-yl)ethoxy]-1,2-diphenylethanone (PubChem CID 54008657) has the molecular formula C34H38N2O7 and a molecular weight of 586.69 g/mol. Its IUPAC name is 2,2-bis[2-(1,3-dihydroxy-4,5,6,7-tetrahydroisoindol-2-yl)ethoxy]-1,2-diphenylethanone.
| Compound Name | 2,2-bis[2-(1,3-dihydroxy-4,5,6,7-tetrahydroisoindol-2-yl)ethoxy]-1,2-diphenylethanone |
|---|---|
| PubChem CID | 54008657 |
| Molecular Formula | C34H38N2O7 |
| Molecular Weight | 586.69 g/mol |
| Exact Mass | 586.27 |
| IUPAC Name | 2,2-bis[2-(1,3-dihydroxy-4,5,6,7-tetrahydroisoindol-2-yl)ethoxy]-1,2-diphenylethanone |
| SMILES | O=C(c1ccccc1)C(OCCn1c(O)c2c(c1O)CCCC2)(OCCn1c(O)c2c(c1O)CCCC2)c1ccccc1 |
| InChI | InChI=1S/C34H38N2O7/c37-29(23-11-3-1-4-12-23)34(24-13-5-2-6-14-24,42-21-19-35-30(38)25-15-7-8-16-26(25)31(35)39)43-22-20-36-32(40)27-17-9-10-18-28(27)33(36)41/h1-6,11-14,38-41H,7-10,15-22H2 |
| InChIKey | KQSMHDUEQIBJEU-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 126.31 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.69 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|