About 2-(1,3-dihydroxy-4,5,6,7-tetrahydroisoindol-2-yl)acetic acid
2-(1,3-dihydroxy-4,5,6,7-tetrahydroisoindol-2-yl)acetic acid (PubChem CID 54223909) has the molecular formula C10H13NO4
and a molecular weight of 211.22 g/mol. Its IUPAC name is 2-(1,3-dihydroxy-4,5,6,7-tetrahydroisoindol-2-yl)acetic acid.
Analyze 2-(1,3-dihydroxy-4,5,6,7-tetrahydroisoindol-2-yl)acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1,3-dihydroxy-4,5,6,7-tetrahydroisoindol-2-yl)acetic acid?
The IUPAC name of 2-(1,3-dihydroxy-4,5,6,7-tetrahydroisoindol-2-yl)acetic acid (CID 54223909) is 2-(1,3-dihydroxy-4,5,6,7-tetrahydroisoindol-2-yl)acetic acid.
What is the SMILES notation for 2-(1,3-dihydroxy-4,5,6,7-tetrahydroisoindol-2-yl)acetic acid?
The canonical SMILES for 2-(1,3-dihydroxy-4,5,6,7-tetrahydroisoindol-2-yl)acetic acid is O=C(O)Cn1c(O)c2c(c1O)CCCC2.
What is the InChIKey of 2-(1,3-dihydroxy-4,5,6,7-tetrahydroisoindol-2-yl)acetic acid?
The InChIKey is QENJEXHGILZCFF-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13NO4/c12-8(13)5-11-9(14)6-3-1-2-4-7(6)10(11)15/h14-15H,1-5H2,(H,12,13).
What are the key properties of 2-(1,3-dihydroxy-4,5,6,7-tetrahydroisoindol-2-yl)acetic acid?
2-(1,3-dihydroxy-4,5,6,7-tetrahydroisoindol-2-yl)acetic acid has a molecular weight of 211.22 g/mol, XLogP of 0.86, 2 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1,3-dihydroxy-4,5,6,7-tetrahydroisoindol-2-yl)acetic acid is sourced from PubChem (CID 54223909), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).