C29H34O4 — CID 157395902
(1,1-dimethoxy-2-phenylethyl)benzene;(1-hydroxycyclohexyl)-phenylmethanone (PubChem CID 157395902) has the molecular formula C29H34O4 and a molecular weight of 446.59 g/mol. Its IUPAC name is (1,1-dimethoxy-2-phenylethyl)benzene;(1-hydroxycyclohexyl)-phenylmethanone.
| Compound Name | (1,1-dimethoxy-2-phenylethyl)benzene;(1-hydroxycyclohexyl)-phenylmethanone |
|---|---|
| PubChem CID | 157395902 |
| Molecular Formula | C29H34O4 |
| Molecular Weight | 446.59 g/mol |
| Exact Mass | 446.25 |
| IUPAC Name | (1,1-dimethoxy-2-phenylethyl)benzene;(1-hydroxycyclohexyl)-phenylmethanone |
| SMILES | COC(Cc1ccccc1)(OC)c1ccccc1.O=C(c1ccccc1)C1(O)CCCCC1 |
| InChI | InChI=1S/C16H18O2.C13H16O2/c1-17-16(18-2,15-11-7-4-8-12-15)13-14-9-5-3-6-10-14;14-12(11-7-3-1-4-8-11)13(15)9-5-2-6-10-13/h3-12H,13H2,1-2H3;1,3-4,7-8,15H,2,5-6,9-10H2 |
| InChIKey | BMOKFKULWWGAFM-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.59 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|