C27H19FO2 — CID 102314756
2-(4-benzoyl-2-fluorophenyl)-1,2-diphenylethanone (PubChem CID 102314756) has the molecular formula C27H19FO2 and a molecular weight of 394.45 g/mol. Its IUPAC name is 2-(4-benzoyl-2-fluorophenyl)-1,2-diphenylethanone.
| Compound Name | 2-(4-benzoyl-2-fluorophenyl)-1,2-diphenylethanone |
|---|---|
| PubChem CID | 102314756 |
| Molecular Formula | C27H19FO2 |
| Molecular Weight | 394.45 g/mol |
| Exact Mass | 394.14 |
| IUPAC Name | 2-(4-benzoyl-2-fluorophenyl)-1,2-diphenylethanone |
| SMILES | O=C(c1ccccc1)c1ccc(C(C(=O)c2ccccc2)c2ccccc2)c(F)c1 |
| InChI | InChI=1S/C27H19FO2/c28-24-18-22(26(29)20-12-6-2-7-13-20)16-17-23(24)25(19-10-4-1-5-11-19)27(30)21-14-8-3-9-15-21/h1-18,25H |
| InChIKey | DPNHEMNTMWSCGM-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.45 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |