C14H11F2NS — CID 174794520
2-(2,4-difluorophenyl)-2-phenylethanethioamide (PubChem CID 174794520) has the molecular formula C14H11F2NS and a molecular weight of 263.31 g/mol. Its IUPAC name is 2-(2,4-difluorophenyl)-2-phenylethanethioamide.
| Compound Name | 2-(2,4-difluorophenyl)-2-phenylethanethioamide |
|---|---|
| PubChem CID | 174794520 |
| Molecular Formula | C14H11F2NS |
| Molecular Weight | 263.31 g/mol |
| Exact Mass | 263.06 |
| IUPAC Name | 2-(2,4-difluorophenyl)-2-phenylethanethioamide |
| SMILES | NC(=S)C(c1ccccc1)c1ccc(F)cc1F |
| InChI | InChI=1S/C14H11F2NS/c15-10-6-7-11(12(16)8-10)13(14(17)18)9-4-2-1-3-5-9/h1-8,13H,(H2,17,18) |
| InChIKey | LEGVDFJNYHNWCA-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.31 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'thio_amide_C(2)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|