C14H18F2N2S — CID 84748603
2-(azepan-1-yl)-2-(2,4-difluorophenyl)ethanethioamide (PubChem CID 84748603) has the molecular formula C14H18F2N2S and a molecular weight of 284.38 g/mol. Its IUPAC name is 2-(azepan-1-yl)-2-(2,4-difluorophenyl)ethanethioamide.
| Compound Name | 2-(azepan-1-yl)-2-(2,4-difluorophenyl)ethanethioamide |
|---|---|
| PubChem CID | 84748603 |
| Molecular Formula | C14H18F2N2S |
| Molecular Weight | 284.38 g/mol |
| Exact Mass | 284.12 |
| IUPAC Name | 2-(azepan-1-yl)-2-(2,4-difluorophenyl)ethanethioamide |
| SMILES | NC(=S)C(c1ccc(F)cc1F)N1CCCCCC1 |
| InChI | InChI=1S/C14H18F2N2S/c15-10-5-6-11(12(16)9-10)13(14(17)19)18-7-3-1-2-4-8-18/h5-6,9,13H,1-4,7-8H2,(H2,17,19) |
| InChIKey | MIIFUKRYCFRAPS-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.38 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|