C17H19NO2 — CID 910794
(2S,3R)-3-methoxy-2-(methylamino)-1,3-diphenylpropan-1-one (PubChem CID 910794) has the molecular formula C17H19NO2 and a molecular weight of 269.34 g/mol. Its IUPAC name is (2S,3R)-3-methoxy-2-(methylamino)-1,3-diphenylpropan-1-one.
| Compound Name | (2S,3R)-3-methoxy-2-(methylamino)-1,3-diphenylpropan-1-one |
|---|---|
| PubChem CID | 910794 |
| Molecular Formula | C17H19NO2 |
| Molecular Weight | 269.34 g/mol |
| Exact Mass | 269.14 |
| IUPAC Name | (2S,3R)-3-methoxy-2-(methylamino)-1,3-diphenylpropan-1-one |
| SMILES | CN[C@H](C(=O)c1ccccc1)[C@H](OC)c1ccccc1 |
| InChI | InChI=1S/C17H19NO2/c1-18-15(16(19)13-9-5-3-6-10-13)17(20-2)14-11-7-4-8-12-14/h3-12,15,17-18H,1-2H3/t15-,17-/m1/s1 |
| InChIKey | UZMATHAVBHQGGQ-NVXWUHKLSA-N |
| XLogP | 2.85 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.34 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |