C17H19ClN2O8 — CID 16682564
3-methoxy-2-(methylamino)-3-(3-nitrophenyl)-1-phenylpropan-1-one;perchloric acid (PubChem CID 16682564) has the molecular formula C17H19ClN2O8 and a molecular weight of 414.80 g/mol. Its IUPAC name is 3-methoxy-2-(methylamino)-3-(3-nitrophenyl)-1-phenylpropan-1-one;perchloric acid.
| Compound Name | 3-methoxy-2-(methylamino)-3-(3-nitrophenyl)-1-phenylpropan-1-one;perchloric acid |
|---|---|
| PubChem CID | 16682564 |
| Molecular Formula | C17H19ClN2O8 |
| Molecular Weight | 414.80 g/mol |
| Exact Mass | 414.08 |
| IUPAC Name | 3-methoxy-2-(methylamino)-3-(3-nitrophenyl)-1-phenylpropan-1-one;perchloric acid |
| SMILES | CNC(C(=O)c1ccccc1)C(OC)c1cccc([N+](=O)[O-])c1.[O-][Cl+3]([O-])([O-])O |
| InChI | InChI=1S/C17H18N2O4.ClHO4/c1-18-15(16(20)12-7-4-3-5-8-12)17(23-2)13-9-6-10-14(11-13)19(21)22;2-1(3,4)5/h3-11,15,17-18H,1-2H3;(H,2,3,4,5) |
| InChIKey | LXRMCWMRMVDWQE-UHFFFAOYSA-N |
| XLogP | -1.37 |
| TPSA | 170.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.80 |
| LogP ≤ 5 | -1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|