C22H19BrN2O5S — CID 135058637
N-[(1R,2R)-2-bromo-1-(3-nitrophenyl)-3-oxo-3-phenylpropyl]-4-methylbenzenesulfonamide (PubChem CID 135058637) has the molecular formula C22H19BrN2O5S and a molecular weight of 503.37 g/mol. Its IUPAC name is N-[(1R,2R)-2-bromo-1-(3-nitrophenyl)-3-oxo-3-phenylpropyl]-4-methylbenzenesulfonamide.
| Compound Name | N-[(1R,2R)-2-bromo-1-(3-nitrophenyl)-3-oxo-3-phenylpropyl]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 135058637 |
| Molecular Formula | C22H19BrN2O5S |
| Molecular Weight | 503.37 g/mol |
| Exact Mass | 502.02 |
| IUPAC Name | N-[(1R,2R)-2-bromo-1-(3-nitrophenyl)-3-oxo-3-phenylpropyl]-4-methylbenzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)N[C@H](c2cccc([N+](=O)[O-])c2)[C@@H](Br)C(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C22H19BrN2O5S/c1-15-10-12-19(13-11-15)31(29,30)24-21(17-8-5-9-18(14-17)25(27)28)20(23)22(26)16-6-3-2-4-7-16/h2-14,20-21,24H,1H3/t20-,21-/m1/s1 |
| InChIKey | UBVVKYCQFFOAQT-NHCUHLMSSA-N |
| XLogP | 4.57 |
| TPSA | 106.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.37 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|