C18H19ClFNO7 — CID 52997470
[1-(4-fluorophenyl)-2-(methylamino)-3-oxo-3-phenylpropyl] acetate;perchloric acid (PubChem CID 52997470) has the molecular formula C18H19ClFNO7 and a molecular weight of 415.80 g/mol. Its IUPAC name is [1-(4-fluorophenyl)-2-(methylamino)-3-oxo-3-phenylpropyl] acetate;perchloric acid.
| Compound Name | [1-(4-fluorophenyl)-2-(methylamino)-3-oxo-3-phenylpropyl] acetate;perchloric acid |
|---|---|
| PubChem CID | 52997470 |
| Molecular Formula | C18H19ClFNO7 |
| Molecular Weight | 415.80 g/mol |
| Exact Mass | 415.08 |
| IUPAC Name | [1-(4-fluorophenyl)-2-(methylamino)-3-oxo-3-phenylpropyl] acetate;perchloric acid |
| SMILES | CNC(C(=O)c1ccccc1)C(OC(C)=O)c1ccc(F)cc1.[O-][Cl+3]([O-])([O-])O |
| InChI | InChI=1S/C18H18FNO3.ClHO4/c1-12(21)23-18(14-8-10-15(19)11-9-14)16(20-2)17(22)13-6-4-3-5-7-13;2-1(3,4)5/h3-11,16,18,20H,1-2H3;(H,2,3,4,5) |
| InChIKey | VBUMFTMJSIOVBP-UHFFFAOYSA-N |
| XLogP | -1.22 |
| TPSA | 144.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.80 |
| LogP ≤ 5 | -1.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |