C18H18O4 — CID 102159626
2-(2,5-dimethoxyphenyl)-1-phenylbutane-1,3-dione (PubChem CID 102159626) has the molecular formula C18H18O4 and a molecular weight of 298.34 g/mol. Its IUPAC name is 2-(2,5-dimethoxyphenyl)-1-phenylbutane-1,3-dione.
| Compound Name | 2-(2,5-dimethoxyphenyl)-1-phenylbutane-1,3-dione |
|---|---|
| PubChem CID | 102159626 |
| Molecular Formula | C18H18O4 |
| Molecular Weight | 298.34 g/mol |
| Exact Mass | 298.12 |
| IUPAC Name | 2-(2,5-dimethoxyphenyl)-1-phenylbutane-1,3-dione |
| SMILES | COc1ccc(OC)c(C(C(C)=O)C(=O)c2ccccc2)c1 |
| InChI | InChI=1S/C18H18O4/c1-12(19)17(18(20)13-7-5-4-6-8-13)15-11-14(21-2)9-10-16(15)22-3/h4-11,17H,1-3H3 |
| InChIKey | AWZRBHNWWOIFLY-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.34 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|