C23H29BrO4 — CID 57027848
8-bromo-2-(2,5-dimethoxyphenyl)-1-(4-methoxyphenyl)octan-1-one (PubChem CID 57027848) has the molecular formula C23H29BrO4 and a molecular weight of 449.39 g/mol. Its IUPAC name is 8-bromo-2-(2,5-dimethoxyphenyl)-1-(4-methoxyphenyl)octan-1-one.
| Compound Name | 8-bromo-2-(2,5-dimethoxyphenyl)-1-(4-methoxyphenyl)octan-1-one |
|---|---|
| PubChem CID | 57027848 |
| Molecular Formula | C23H29BrO4 |
| Molecular Weight | 449.39 g/mol |
| Exact Mass | 448.12 |
| IUPAC Name | 8-bromo-2-(2,5-dimethoxyphenyl)-1-(4-methoxyphenyl)octan-1-one |
| SMILES | COc1ccc(C(=O)C(CCCCCCBr)c2cc(OC)ccc2OC)cc1 |
| InChI | InChI=1S/C23H29BrO4/c1-26-18-11-9-17(10-12-18)23(25)20(8-6-4-5-7-15-24)21-16-19(27-2)13-14-22(21)28-3/h9-14,16,20H,4-8,15H2,1-3H3 |
| InChIKey | SDIDHTTWHQELOZ-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.39 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|