C17H15ClO5S — CID 174461899
2-(1,3-dioxo-1-phenylbutan-2-yl)-5-methoxybenzenesulfonyl chloride (PubChem CID 174461899) has the molecular formula C17H15ClO5S and a molecular weight of 366.82 g/mol. Its IUPAC name is 2-(1,3-dioxo-1-phenylbutan-2-yl)-5-methoxybenzenesulfonyl chloride.
| Compound Name | 2-(1,3-dioxo-1-phenylbutan-2-yl)-5-methoxybenzenesulfonyl chloride |
|---|---|
| PubChem CID | 174461899 |
| Molecular Formula | C17H15ClO5S |
| Molecular Weight | 366.82 g/mol |
| Exact Mass | 366.03 |
| IUPAC Name | 2-(1,3-dioxo-1-phenylbutan-2-yl)-5-methoxybenzenesulfonyl chloride |
| SMILES | COc1ccc(C(C(C)=O)C(=O)c2ccccc2)c(S(=O)(=O)Cl)c1 |
| InChI | InChI=1S/C17H15ClO5S/c1-11(19)16(17(20)12-6-4-3-5-7-12)14-9-8-13(23-2)10-15(14)24(18,21)22/h3-10,16H,1-2H3 |
| InChIKey | USONHWGGVBMSEP-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.82 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|