C17H18FNO3 — CID 97428316
(E)-N-[(2R)-2-(2-fluorophenyl)-2-methoxypropyl]-3-(furan-2-yl)prop-2-enamide (PubChem CID 97428316) has the molecular formula C17H18FNO3 and a molecular weight of 303.33 g/mol. Its IUPAC name is (E)-N-[(2R)-2-(2-fluorophenyl)-2-methoxypropyl]-3-(furan-2-yl)prop-2-enamide.
| Compound Name | (E)-N-[(2R)-2-(2-fluorophenyl)-2-methoxypropyl]-3-(furan-2-yl)prop-2-enamide |
|---|---|
| PubChem CID | 97428316 |
| Molecular Formula | C17H18FNO3 |
| Molecular Weight | 303.33 g/mol |
| Exact Mass | 303.13 |
| IUPAC Name | (E)-N-[(2R)-2-(2-fluorophenyl)-2-methoxypropyl]-3-(furan-2-yl)prop-2-enamide |
| SMILES | CO[C@@](C)(CNC(=O)/C=C/c1ccco1)c1ccccc1F |
| InChI | InChI=1S/C17H18FNO3/c1-17(21-2,14-7-3-4-8-15(14)18)12-19-16(20)10-9-13-6-5-11-22-13/h3-11H,12H2,1-2H3,(H,19,20)/b10-9+/t17-/m0/s1 |
| InChIKey | PGLCJJFSRWUUIL-FVNWOWOISA-N |
| XLogP | 3.11 |
| TPSA | 51.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.33 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|