C12H13BrO3 — CID 170872964
(E)-3-(5-bromo-2-ethoxyphenyl)-2-methylprop-2-enoic acid (PubChem CID 170872964) has the molecular formula C12H13BrO3 and a molecular weight of 285.14 g/mol. Its IUPAC name is (E)-3-(5-bromo-2-ethoxyphenyl)-2-methylprop-2-enoic acid.
| Compound Name | (E)-3-(5-bromo-2-ethoxyphenyl)-2-methylprop-2-enoic acid |
|---|---|
| PubChem CID | 170872964 |
| Molecular Formula | C12H13BrO3 |
| Molecular Weight | 285.14 g/mol |
| Exact Mass | 284.00 |
| IUPAC Name | (E)-3-(5-bromo-2-ethoxyphenyl)-2-methylprop-2-enoic acid |
| SMILES | CCOc1ccc(Br)cc1/C=C(\C)C(=O)O |
| InChI | InChI=1S/C12H13BrO3/c1-3-16-11-5-4-10(13)7-9(11)6-8(2)12(14)15/h4-7H,3H2,1-2H3,(H,14,15)/b8-6+ |
| InChIKey | QHQIEGLKTRDLKZ-SOFGYWHQSA-N |
| XLogP | 3.34 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.14 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|